| Name | 1-(chloroacetyl)pyrrolidine |
| Synonyms | AI3-36314 AKOS BBS-00000922 TIMTEC-BB SBB005370 ASINEX-REAG BAS 12710677 1-(Chloroacetyl)pyrrolidine 1-(chloroacetyl)pyrrolidine 1-(CHLOROACETYL)PYRROLIDINE Pyrrolidine, 1-(chloroacetyl)- 2-CHLORO-1-PYRROLIDIN-1-YL-ETHANONE 2-chloro-1-(pyrrolidin-1-yl)ethanone Pyrrolidine, 1-(chloroacetyl)- (6CI,7CI,8CI,9CI) |
| CAS | 20266-00-6 |
| EINECS | 243-658-6 |
| InChI | InChI=1/C6H10ClNO/c7-5-6(9)8-3-1-2-4-8/h1-5H2 |
| InChIKey | AAOSLLBWWRKJIR-UHFFFAOYSA-N |
| Molecular Formula | C6H10ClNO |
| Molar Mass | 147.6 |
| Density | 1.205±0.06 g/cm3(Predicted) |
| Melting Point | 46-47°C |
| Boling Point | 105°C/1.3mmHg(lit.) |
| Flash Point | 106.8°C |
| Vapor Presure | 0.0188mmHg at 25°C |
| pKa | -0.95±0.20(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.501 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Hazard Class | IRRITANT |